| Name | 2-Chloro-1H-indole-3-carbaldehyde |
| Synonyms | RARECHEM AK ML 0105 2-Chloro-3-formyl-1H-indole 2-Chloro-indole-3-carbaldehyde 2-CHLORO-INDOLE-3-CARBALDEHYDE 2-CHLORO-1H-INDOLE-3-CARBALDEHYDE 2-Chloro-1H-indole-3-carbaldehyde 2-CHLORO-1H-INDOLE-3-CARBOXALDEHYDE 1H-Indole-3-carboxaldehyde, 2-chloro- |
| CAS | 5059-30-3 |
| InChI | InChI=1/C9H6ClNO/c10-9-7(5-12)6-3-1-2-4-8(6)11-9/h1-5,11H |
| Molecular Formula | C9H6ClNO |
| Molar Mass | 179.6 |
| Density | 1.431±0.06 g/cm3(Predicted) |
| Melting Point | ca 212℃ |
| Boling Point | 364.7±22.0 °C(Predicted) |
| Flash Point | 174.3°C |
| Water Solubility | Slightly soluble in water. |
| Vapor Presure | 1.66E-05mmHg at 25°C |
| pKa | 13.90±0.30(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.731 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| Hazard Class | IRRITANT |